ChemNet > CAS > 111128-12-2 2-(4-Bromomethyl)phenylpropionic acid
111128-12-2 2-(4-Bromomethyl)phenylpropionic acid
| product Name |
2-(4-Bromomethyl)phenylpropionic acid |
| CAS No |
111128-12-2 |
| Synonyms |
P-Bromomethylphenylpropionic Acid; 4-(Bromomethyl)Hydratropic Acid; 2-[4-(Bromomethyl)Phenyl]Propanoic Acid; 2-[4-(Bromomethyl)Phenyl]Propionic Acid; 2-[(P-Bromomethyl)Phenyl]Propionic Acid Bmppa; 2-[4-(Bromomethyl)phenyl]propinic acid; Loxoprofen Intermediate; 2-((4-Bromomethyl)phenyl)propanic acid; 2-(4-bromomethylphenyl)propionic acid (intermediate of loxoprofen); 2-[4-(bromomethyl)phenyl]propanoic acid (intermediate of loxoprofen); 2-[(P-bromomethyl)phenyl] propionic acid; 2-(4-(bromomethyl)phenyl)propanoic acid; (2S)-2-[4-(bromomethyl)phenyl]propanoate; (2R)-2-[4-(bromomethyl)phenyl]propanoate; 2-[(4-Bromomethyl)Phenyl]Propionic Acid; 2-(4-Bromomethyl)phenylpropionic acid (BMPPA); 2-(4-Bromomethyl) phenylpropionic acid; 4-bromomethyl phenyl propionic acid |
| Molecular Formula |
C10H10BrO2 |
| Molecular Weight |
242.0897 |
| InChI |
InChI=1/C10H11BrO2/c1-7(10(12)13)9-4-2-8(6-11)3-5-9/h2-5,7H,6H2,1H3,(H,12,13)/p-1/t7-/m1/s1 |
| Molecular Structure |
|
| Melting point |
123-128℃ |
| Boiling point |
344.2°C at 760 mmHg |
| Flash point |
162°C |
| Vapour Pressur |
2.54E-05mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:;
|
| Safety Description |
S26:;
S37/39:;
|
| MSDS |
Material Safety Data Sheet
|
|